C18H20ClLiO3P — CID 70013385
CID 70013385 (PubChem CID 70013385) has the molecular formula C18H20ClLiO3P and a molecular weight of 357.72 g/mol.
| Compound Name | CID 70013385 |
|---|---|
| PubChem CID | 70013385 |
| Molecular Formula | C18H20ClLiO3P |
| Molecular Weight | 357.72 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | — |
| SMILES | CCOc1ccc(PC(=O)c2c(C)cccc2Cl)c(OCC)c1.[Li] |
| InChI | InChI=1S/C18H20ClO3P.Li/c1-4-21-13-9-10-16(15(11-13)22-5-2)23-18(20)17-12(3)7-6-8-14(17)19;/h6-11,23H,4-5H2,1-3H3; |
| InChIKey | RYUFHDPOTCVYOU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.72 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|