C24H33ClLiO3P — CID 173243886
lithium;(2-chloro-6-methylphenyl)-(2,4-dipentoxyphenyl)phosphanylmethanone;hydride (PubChem CID 173243886) has the molecular formula C24H33ClLiO3P and a molecular weight of 442.89 g/mol. Its IUPAC name is lithium;(2-chloro-6-methylphenyl)-(2,4-dipentoxyphenyl)phosphanylmethanone;hydride.
| Compound Name | lithium;(2-chloro-6-methylphenyl)-(2,4-dipentoxyphenyl)phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173243886 |
| Molecular Formula | C24H33ClLiO3P |
| Molecular Weight | 442.89 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | lithium;(2-chloro-6-methylphenyl)-(2,4-dipentoxyphenyl)phosphanylmethanone;hydride |
| SMILES | CCCCCOc1ccc(PC(=O)c2c(C)cccc2Cl)c(OCCCCC)c1.[H-].[Li+] |
| InChI | InChI=1S/C24H32ClO3P.Li.H/c1-4-6-8-15-27-19-13-14-22(21(17-19)28-16-9-7-5-2)29-24(26)23-18(3)11-10-12-20(23)25;;/h10-14,17,29H,4-9,15-16H2,1-3H3;;/q;+1;-1 |
| InChIKey | GJBIYHKIRYNIJQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|