C24H33LiO3P+ — CID 18513784
lithium (2,4-dibutoxyphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone (PubChem CID 18513784) has the molecular formula C24H33LiO3P+ and a molecular weight of 407.44 g/mol. Its IUPAC name is lithium (2,4-dibutoxyphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | lithium (2,4-dibutoxyphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 18513784 |
| Molecular Formula | C24H33LiO3P+ |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | lithium (2,4-dibutoxyphenyl)phosphanyl-(2,4,6-trimethylphenyl)methanone |
| SMILES | CCCCOc1ccc(PC(=O)c2c(C)cc(C)cc2C)c(OCCCC)c1.[Li+] |
| InChI | InChI=1S/C24H33O3P.Li/c1-6-8-12-26-20-10-11-22(21(16-20)27-13-9-7-2)28-24(25)23-18(4)14-17(3)15-19(23)5;/h10-11,14-16,28H,6-9,12-13H2,1-5H3;/q;+1 |
| InChIKey | HCUYSLCLGIIOLC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|