C22H29LiO3P+ — CID 18514113
lithium [2,4-di(propan-2-yloxy)phenyl]phosphanyl-(2,4,6-trimethylphenyl)methanone (PubChem CID 18514113) has the molecular formula C22H29LiO3P+ and a molecular weight of 379.39 g/mol. Its IUPAC name is lithium [2,4-di(propan-2-yloxy)phenyl]phosphanyl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | lithium [2,4-di(propan-2-yloxy)phenyl]phosphanyl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 18514113 |
| Molecular Formula | C22H29LiO3P+ |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | lithium [2,4-di(propan-2-yloxy)phenyl]phosphanyl-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)Pc2ccc(OC(C)C)cc2OC(C)C)c(C)c1.[Li+] |
| InChI | InChI=1S/C22H29O3P.Li/c1-13(2)24-18-8-9-20(19(12-18)25-14(3)4)26-22(23)21-16(6)10-15(5)11-17(21)7;/h8-14,26H,1-7H3;/q;+1 |
| InChIKey | UVSAVXOPGDCXOL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|