C21H28LiO3P — CID 173243873
lithium;(2,6-dimethylphenyl)-[2,4-di(propan-2-yloxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173243873) has the molecular formula C21H28LiO3P and a molecular weight of 366.37 g/mol. Its IUPAC name is lithium;(2,6-dimethylphenyl)-[2,4-di(propan-2-yloxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dimethylphenyl)-[2,4-di(propan-2-yloxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173243873 |
| Molecular Formula | C21H28LiO3P |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | lithium;(2,6-dimethylphenyl)-[2,4-di(propan-2-yloxy)phenyl]phosphanylmethanone;hydride |
| SMILES | Cc1cccc(C)c1C(=O)Pc1ccc(OC(C)C)cc1OC(C)C.[H-].[Li+] |
| InChI | InChI=1S/C21H27O3P.Li.H/c1-13(2)23-17-10-11-19(18(12-17)24-14(3)4)25-21(22)20-15(5)8-7-9-16(20)6;;/h7-14,25H,1-6H3;;/q;+1;-1 |
| InChIKey | GBACJSYMWPKPTM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|