C29H27LiO3P+ — CID 18514058
lithium [2,4-bis(phenylmethoxy)phenyl]phosphanyl-(2,6-dimethylphenyl)methanone (PubChem CID 18514058) has the molecular formula C29H27LiO3P+ and a molecular weight of 461.45 g/mol. Its IUPAC name is lithium [2,4-bis(phenylmethoxy)phenyl]phosphanyl-(2,6-dimethylphenyl)methanone.
| Compound Name | lithium [2,4-bis(phenylmethoxy)phenyl]phosphanyl-(2,6-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 18514058 |
| Molecular Formula | C29H27LiO3P+ |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | lithium [2,4-bis(phenylmethoxy)phenyl]phosphanyl-(2,6-dimethylphenyl)methanone |
| SMILES | Cc1cccc(C)c1C(=O)Pc1ccc(OCc2ccccc2)cc1OCc1ccccc1.[Li+] |
| InChI | InChI=1S/C29H27O3P.Li/c1-21-10-9-11-22(2)28(21)29(30)33-27-17-16-25(31-19-23-12-5-3-6-13-23)18-26(27)32-20-24-14-7-4-8-15-24;/h3-18,33H,19-20H2,1-2H3;/q;+1 |
| InChIKey | HONDSLQDOPQWNT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|