C31H31LiO3P+ — CID 18514044
lithium [2,4-bis(phenylmethoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone (PubChem CID 18514044) has the molecular formula C31H31LiO3P+ and a molecular weight of 489.50 g/mol. Its IUPAC name is lithium [2,4-bis(phenylmethoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone.
| Compound Name | lithium [2,4-bis(phenylmethoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone |
|---|---|
| PubChem CID | 18514044 |
| Molecular Formula | C31H31LiO3P+ |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | lithium [2,4-bis(phenylmethoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)Pc2ccc(OCc3ccccc3)cc2OCc2ccccc2)c(C)c1C.[Li+] |
| InChI | InChI=1S/C31H31O3P.Li/c1-21-17-22(2)30(24(4)23(21)3)31(32)35-29-16-15-27(33-19-25-11-7-5-8-12-25)18-28(29)34-20-26-13-9-6-10-14-26;/h5-18,35H,19-20H2,1-4H3;/q;+1 |
| InChIKey | ZCOYVRKJUSTJQJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|