C23H23O5P — CID 18513508
(4-phenylmethoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone (PubChem CID 18513508) has the molecular formula C23H23O5P and a molecular weight of 410.41 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone.
| Compound Name | (4-phenylmethoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 18513508 |
| Molecular Formula | C23H23O5P |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (4-phenylmethoxyphenyl)phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)c(C(=O)Pc2ccc(OCc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H23O5P/c1-25-18-13-20(26-2)22(21(14-18)27-3)23(24)29-19-11-9-17(10-12-19)28-15-16-7-5-4-6-8-16/h4-14,29H,15H2,1-3H3 |
| InChIKey | YECDLFPSMWKCLP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|