C36H34LiO6P — CID 173245136
lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173245136) has the molecular formula C36H34LiO6P and a molecular weight of 600.58 g/mol. Its IUPAC name is lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245136 |
| Molecular Formula | C36H34LiO6P |
| Molecular Weight | 600.58 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | lithium;(2,6-dimethoxyphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | COc1cccc(OC)c1C(=O)Pc1c(OCc2ccccc2)cc(OCc2ccccc2)cc1OCc1ccccc1.[H-].[Li+] |
| InChI | InChI=1S/C36H33O6P.Li.H/c1-38-30-19-12-20-31(39-2)34(30)36(37)43-35-32(41-24-27-15-8-4-9-16-27)21-29(40-23-26-13-6-3-7-14-26)22-33(35)42-25-28-17-10-5-11-18-28;;/h3-22,43H,23-25H2,1-2H3;;/q;+1;-1 |
| InChIKey | SPROOJHISHGAHR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|