C36H33LiO4P+ — CID 18514819
lithium (2,6-dimethylphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone (PubChem CID 18514819) has the molecular formula C36H33LiO4P+ and a molecular weight of 567.57 g/mol. Its IUPAC name is lithium (2,6-dimethylphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone.
| Compound Name | lithium (2,6-dimethylphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 18514819 |
| Molecular Formula | C36H33LiO4P+ |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | lithium (2,6-dimethylphenyl)-[2,4,6-tris(phenylmethoxy)phenyl]phosphanylmethanone |
| SMILES | Cc1cccc(C)c1C(=O)Pc1c(OCc2ccccc2)cc(OCc2ccccc2)cc1OCc1ccccc1.[Li+] |
| InChI | InChI=1S/C36H33O4P.Li/c1-26-13-12-14-27(2)34(26)36(37)41-35-32(39-24-29-17-8-4-9-18-29)21-31(38-23-28-15-6-3-7-16-28)22-33(35)40-25-30-19-10-5-11-20-30;/h3-22,41H,23-25H2,1-2H3;/q;+1 |
| InChIKey | HZEXIIXQMVGBTP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|