C24H26O4 — CID 142024512
ethane;2-methyl-6-[(3-phenylmethoxyphenoxy)methyl]benzoic acid (PubChem CID 142024512) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethane;2-methyl-6-[(3-phenylmethoxyphenoxy)methyl]benzoic acid.
| Compound Name | ethane;2-methyl-6-[(3-phenylmethoxyphenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 142024512 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | ethane;2-methyl-6-[(3-phenylmethoxyphenoxy)methyl]benzoic acid |
| SMILES | CC.Cc1cccc(COc2cccc(OCc3ccccc3)c2)c1C(=O)O |
| InChI | InChI=1S/C22H20O4.C2H6/c1-16-7-5-10-18(21(16)22(23)24)15-26-20-12-6-11-19(13-20)25-14-17-8-3-2-4-9-17;1-2/h2-13H,14-15H2,1H3,(H,23,24);1-2H3 |
| InChIKey | INGYJTFXKSBUOY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |