C21H19NO4 — CID 22241542
2-methyl-6-[[3-(pyridin-2-ylmethoxy)phenoxy]methyl]benzoic acid (PubChem CID 22241542) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-methyl-6-[[3-(pyridin-2-ylmethoxy)phenoxy]methyl]benzoic acid.
| Compound Name | 2-methyl-6-[[3-(pyridin-2-ylmethoxy)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 22241542 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-methyl-6-[[3-(pyridin-2-ylmethoxy)phenoxy]methyl]benzoic acid |
| SMILES | Cc1cccc(COc2cccc(OCc3ccccn3)c2)c1C(=O)O |
| InChI | InChI=1S/C21H19NO4/c1-15-6-4-7-16(20(15)21(23)24)13-25-18-9-5-10-19(12-18)26-14-17-8-2-3-11-22-17/h2-12H,13-14H2,1H3,(H,23,24) |
| InChIKey | HNNOFFIPDRKUAR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |