C25H22N2O5 — CID 22241519
2-methyl-6-[[3-[(3-methyl-4-oxoquinazolin-2-yl)methoxy]phenoxy]methyl]benzoic acid (PubChem CID 22241519) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-methyl-6-[[3-[(3-methyl-4-oxoquinazolin-2-yl)methoxy]phenoxy]methyl]benzoic acid.
| Compound Name | 2-methyl-6-[[3-[(3-methyl-4-oxoquinazolin-2-yl)methoxy]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 22241519 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-methyl-6-[[3-[(3-methyl-4-oxoquinazolin-2-yl)methoxy]phenoxy]methyl]benzoic acid |
| SMILES | Cc1cccc(COc2cccc(OCc3nc4ccccc4c(=O)n3C)c2)c1C(=O)O |
| InChI | InChI=1S/C25H22N2O5/c1-16-7-5-8-17(23(16)25(29)30)14-31-18-9-6-10-19(13-18)32-15-22-26-21-12-4-3-11-20(21)24(28)27(22)2/h3-13H,14-15H2,1-2H3,(H,29,30) |
| InChIKey | KVTLUKBYZMAFGG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |