C28H24O4 — CID 22241403
2-methyl-6-[[3-[(4-phenylphenyl)methoxy]phenoxy]methyl]benzoic acid (PubChem CID 22241403) has the molecular formula C28H24O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-methyl-6-[[3-[(4-phenylphenyl)methoxy]phenoxy]methyl]benzoic acid.
| Compound Name | 2-methyl-6-[[3-[(4-phenylphenyl)methoxy]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 22241403 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-methyl-6-[[3-[(4-phenylphenyl)methoxy]phenoxy]methyl]benzoic acid |
| SMILES | Cc1cccc(COc2cccc(OCc3ccc(-c4ccccc4)cc3)c2)c1C(=O)O |
| InChI | InChI=1S/C28H24O4/c1-20-7-5-10-24(27(20)28(29)30)19-32-26-12-6-11-25(17-26)31-18-21-13-15-23(16-14-21)22-8-3-2-4-9-22/h2-17H,18-19H2,1H3,(H,29,30) |
| InChIKey | XXISGLPLGYCRNR-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |