C27H25NO4 — CID 142024369
2-[[3-[(6-methoxynaphthalen-2-yl)methoxy]phenoxy]methyl]-6-methylbenzamide (PubChem CID 142024369) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is 2-[[3-[(6-methoxynaphthalen-2-yl)methoxy]phenoxy]methyl]-6-methylbenzamide.
| Compound Name | 2-[[3-[(6-methoxynaphthalen-2-yl)methoxy]phenoxy]methyl]-6-methylbenzamide |
|---|---|
| PubChem CID | 142024369 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[[3-[(6-methoxynaphthalen-2-yl)methoxy]phenoxy]methyl]-6-methylbenzamide |
| SMILES | COc1ccc2cc(COc3cccc(OCc4cccc(C)c4C(N)=O)c3)ccc2c1 |
| InChI | InChI=1S/C27H25NO4/c1-18-5-3-6-22(26(18)27(28)29)17-32-25-8-4-7-24(15-25)31-16-19-9-10-21-14-23(30-2)12-11-20(21)13-19/h3-15H,16-17H2,1-2H3,(H2,28,29) |
| InChIKey | URPOFOJDZQHAET-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |