About (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate
(3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 102519033) has the molecular formula C27H24O4
and a molecular weight of 412.49 g/mol. Its IUPAC name is (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
Molecular Properties
| Compound Name | (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| PubChem CID | 102519033 |
| Molecular Formula | C27H24O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)Oc3cccc(OCc4ccccc4)c3)ccc2c1 |
| InChI | InChI=1S/C27H24O4/c1-19(21-11-12-23-16-24(29-2)14-13-22(23)15-21)27(28)31-26-10-6-9-25(17-26)30-18-20-7-4-3-5-8-20/h3-17,19H,18H2,1-2H3/t19-/m0/s1 |
| InChIKey | OCYRQTFMLXYUEY-IBGZPJMESA-N |
| XLogP | 6.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
The IUPAC name of (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (CID 102519033) is (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
What is the SMILES notation for (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
The canonical SMILES for (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate is COc1ccc2cc([C@H](C)C(=O)Oc3cccc(OCc4ccccc4)c3)ccc2c1.
What is the InChIKey of (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
The InChIKey is OCYRQTFMLXYUEY-IBGZPJMESA-N. The full InChI is InChI=1S/C27H24O4/c1-19(21-11-12-23-16-24(29-2)14-13-22(23)15-21)27(28)31-26-10-6-9-25(17-26)30-18-20-7-4-3-5-8-20/h3-17,19H,18H2,1-2H3/t19-/m0/s1.
What are the key properties of (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate?
(3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate has a molecular weight of 412.49 g/mol, XLogP of 6.14, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylmethoxyphenyl) (2S)-2-(6-methoxynaphthalen-2-yl)propanoate is sourced from PubChem (CID 102519033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).