About (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate
(3-phenylmethoxyphenyl) (2S)-2-aminopropanoate (PubChem CID 67767154) has the molecular formula C16H17NO3
and a molecular weight of 271.32 g/mol. Its IUPAC name is (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate |
| PubChem CID | 67767154 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)Oc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C16H17NO3/c1-12(17)16(18)20-15-9-5-8-14(10-15)19-11-13-6-3-2-4-7-13/h2-10,12H,11,17H2,1H3/t12-/m0/s1 |
| InChIKey | ZLGSFLWIOKUFPW-LBPRGKRZSA-N |
| XLogP | 2.52 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate?
The IUPAC name of (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate (CID 67767154) is (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate.
What is the SMILES notation for (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate?
The canonical SMILES for (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate is C[C@H](N)C(=O)Oc1cccc(OCc2ccccc2)c1.
What is the InChIKey of (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate?
The InChIKey is ZLGSFLWIOKUFPW-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H17NO3/c1-12(17)16(18)20-15-9-5-8-14(10-15)19-11-13-6-3-2-4-7-13/h2-10,12H,11,17H2,1H3/t12-/m0/s1.
What are the key properties of (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate?
(3-phenylmethoxyphenyl) (2S)-2-aminopropanoate has a molecular weight of 271.32 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylmethoxyphenyl) (2S)-2-aminopropanoate is sourced from PubChem (CID 67767154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).