C33H34O3 — CID 139719265
3,5-bis(3-phenylmethoxyphenyl)heptan-4-one (PubChem CID 139719265) has the molecular formula C33H34O3 and a molecular weight of 478.63 g/mol. Its IUPAC name is 3,5-bis(3-phenylmethoxyphenyl)heptan-4-one.
| Compound Name | 3,5-bis(3-phenylmethoxyphenyl)heptan-4-one |
|---|---|
| PubChem CID | 139719265 |
| Molecular Formula | C33H34O3 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 3,5-bis(3-phenylmethoxyphenyl)heptan-4-one |
| SMILES | CCC(C(=O)C(CC)c1cccc(OCc2ccccc2)c1)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H34O3/c1-3-31(27-17-11-19-29(21-27)35-23-25-13-7-5-8-14-25)33(34)32(4-2)28-18-12-20-30(22-28)36-24-26-15-9-6-10-16-26/h5-22,31-32H,3-4,23-24H2,1-2H3 |
| InChIKey | ILSMHFFNORUXMP-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |