C18H19F2NO3 — CID 171250199
ethyl (3S)-3-amino-2,2-difluoro-3-(3-phenylmethoxyphenyl)propanoate (PubChem CID 171250199) has the molecular formula C18H19F2NO3 and a molecular weight of 335.35 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2,2-difluoro-3-(3-phenylmethoxyphenyl)propanoate.
| Compound Name | ethyl (3S)-3-amino-2,2-difluoro-3-(3-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 171250199 |
| Molecular Formula | C18H19F2NO3 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | ethyl (3S)-3-amino-2,2-difluoro-3-(3-phenylmethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(F)(F)[C@@H](N)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H19F2NO3/c1-2-23-17(22)18(19,20)16(21)14-9-6-10-15(11-14)24-12-13-7-4-3-5-8-13/h3-11,16H,2,12,21H2,1H3/t16-/m0/s1 |
| InChIKey | WRUUBPDUIKWIBH-INIZCTEOSA-N |
| XLogP | 3.46 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |