C16H14F5NO — CID 171312580
(1R)-2,2,3,3,3-pentafluoro-1-(3-phenylmethoxyphenyl)propan-1-amine (PubChem CID 171312580) has the molecular formula C16H14F5NO and a molecular weight of 331.28 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-(3-phenylmethoxyphenyl)propan-1-amine.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-(3-phenylmethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 171312580 |
| Molecular Formula | C16H14F5NO |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-(3-phenylmethoxyphenyl)propan-1-amine |
| SMILES | N[C@H](c1cccc(OCc2ccccc2)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H14F5NO/c17-15(18,16(19,20)21)14(22)12-7-4-8-13(9-12)23-10-11-5-2-1-3-6-11/h1-9,14H,10,22H2/t14-/m1/s1 |
| InChIKey | IUQAENRLZBBCKA-CQSZACIVSA-N |
| XLogP | 4.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|