C17H23ClN2O — CID 171230857
(1S)-1-(3-phenylmethoxyphenyl)butane-1,4-diamine;hydrochloride (PubChem CID 171230857) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is (1S)-1-(3-phenylmethoxyphenyl)butane-1,4-diamine;hydrochloride.
| Compound Name | (1S)-1-(3-phenylmethoxyphenyl)butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171230857 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (1S)-1-(3-phenylmethoxyphenyl)butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@H](N)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H22N2O.ClH/c18-11-5-10-17(19)15-8-4-9-16(12-15)20-13-14-6-2-1-3-7-14;/h1-4,6-9,12,17H,5,10-11,13,18-19H2;1H/t17-;/m0./s1 |
| InChIKey | MAQXKQKHQIKCIP-LMOVPXPDSA-N |
| XLogP | 3.43 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |