C11H17ClF2N2O — CID 171206110
(1R)-1-[3-(difluoromethoxy)phenyl]butane-1,4-diamine;hydrochloride (PubChem CID 171206110) has the molecular formula C11H17ClF2N2O and a molecular weight of 266.72 g/mol. Its IUPAC name is (1R)-1-[3-(difluoromethoxy)phenyl]butane-1,4-diamine;hydrochloride.
| Compound Name | (1R)-1-[3-(difluoromethoxy)phenyl]butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 171206110 |
| Molecular Formula | C11H17ClF2N2O |
| Molecular Weight | 266.72 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (1R)-1-[3-(difluoromethoxy)phenyl]butane-1,4-diamine;hydrochloride |
| SMILES | Cl.NCCC[C@@H](N)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C11H16F2N2O.ClH/c12-11(13)16-9-4-1-3-8(7-9)10(15)5-2-6-14;/h1,3-4,7,10-11H,2,5-6,14-15H2;1H/t10-;/m1./s1 |
| InChIKey | VXVYNQCGBJLNAG-HNCPQSOCSA-N |
| XLogP | 2.45 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |