C13H18F4N2O — CID 171228173
(1S)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pentane-1,5-diamine (PubChem CID 171228173) has the molecular formula C13H18F4N2O and a molecular weight of 294.29 g/mol. Its IUPAC name is (1S)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pentane-1,5-diamine.
| Compound Name | (1S)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 171228173 |
| Molecular Formula | C13H18F4N2O |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (1S)-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]pentane-1,5-diamine |
| SMILES | NCCCC[C@H](N)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H18F4N2O/c14-12(15)13(16,17)20-10-5-3-4-9(8-10)11(19)6-1-2-7-18/h3-5,8,11-12H,1-2,6-7,18-19H2/t11-/m0/s1 |
| InChIKey | UULBILLBHYWBBS-NSHDSACASA-N |
| XLogP | 3.05 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|