C11H10F7NO — CID 171228193
(1S)-3,3,3-trifluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine (PubChem CID 171228193) has the molecular formula C11H10F7NO and a molecular weight of 305.19 g/mol. Its IUPAC name is (1S)-3,3,3-trifluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine.
| Compound Name | (1S)-3,3,3-trifluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 171228193 |
| Molecular Formula | C11H10F7NO |
| Molecular Weight | 305.19 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | (1S)-3,3,3-trifluoro-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propan-1-amine |
| SMILES | N[C@@H](CC(F)(F)F)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C11H10F7NO/c12-9(13)11(17,18)20-7-3-1-2-6(4-7)8(19)5-10(14,15)16/h1-4,8-9H,5,19H2/t8-/m0/s1 |
| InChIKey | NBBLNJXXDGLMED-QMMMGPOBSA-N |
| XLogP | 3.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.19 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|