C12H18F3N — CID 156724875
ethane;3,3,3-trifluoro-1-(3-methylphenyl)propan-1-amine (PubChem CID 156724875) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is ethane;3,3,3-trifluoro-1-(3-methylphenyl)propan-1-amine.
| Compound Name | ethane;3,3,3-trifluoro-1-(3-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 156724875 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | ethane;3,3,3-trifluoro-1-(3-methylphenyl)propan-1-amine |
| SMILES | CC.Cc1cccc(C(N)CC(F)(F)F)c1 |
| InChI | InChI=1S/C10H12F3N.C2H6/c1-7-3-2-4-8(5-7)9(14)6-10(11,12)13;1-2/h2-5,9H,6,14H2,1H3;1-2H3 |
| InChIKey | ZWZYINOLWVDEBX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |