C15H14F3NO — CID 112693450
3,3,3-trifluoro-1-(3-phenoxyphenyl)propan-1-amine (PubChem CID 112693450) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-(3-phenoxyphenyl)propan-1-amine.
| Compound Name | 3,3,3-trifluoro-1-(3-phenoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 112693450 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3,3,3-trifluoro-1-(3-phenoxyphenyl)propan-1-amine |
| SMILES | NC(CC(F)(F)F)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C15H14F3NO/c16-15(17,18)10-14(19)11-5-4-8-13(9-11)20-12-6-2-1-3-7-12/h1-9,14H,10,19H2 |
| InChIKey | XVFNFYRDFNPLOS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |