C11H13ClF3NO2 — CID 171229347
[3-[(1S)-1-amino-3,3,3-trifluoropropyl]phenyl] acetate;hydrochloride (PubChem CID 171229347) has the molecular formula C11H13ClF3NO2 and a molecular weight of 283.68 g/mol. Its IUPAC name is [3-[(1S)-1-amino-3,3,3-trifluoropropyl]phenyl] acetate;hydrochloride.
| Compound Name | [3-[(1S)-1-amino-3,3,3-trifluoropropyl]phenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171229347 |
| Molecular Formula | C11H13ClF3NO2 |
| Molecular Weight | 283.68 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | [3-[(1S)-1-amino-3,3,3-trifluoropropyl]phenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1cccc([C@@H](N)CC(F)(F)F)c1.Cl |
| InChI | InChI=1S/C11H12F3NO2.ClH/c1-7(16)17-9-4-2-3-8(5-9)10(15)6-11(12,13)14;/h2-5,10H,6,15H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | FXMIXXONXGZHKR-PPHPATTJSA-N |
| XLogP | 2.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|