C14H19NO4 — CID 171249651
methyl (3S)-3-(3-acetyloxyphenyl)-3-amino-2,2-dimethylpropanoate (PubChem CID 171249651) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl (3S)-3-(3-acetyloxyphenyl)-3-amino-2,2-dimethylpropanoate.
| Compound Name | methyl (3S)-3-(3-acetyloxyphenyl)-3-amino-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171249651 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | methyl (3S)-3-(3-acetyloxyphenyl)-3-amino-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@@H](N)c1cccc(OC(C)=O)c1 |
| InChI | InChI=1S/C14H19NO4/c1-9(16)19-11-7-5-6-10(8-11)12(15)14(2,3)13(17)18-4/h5-8,12H,15H2,1-4H3/t12-/m0/s1 |
| InChIKey | XVLGXYSMVAFXQR-LBPRGKRZSA-N |
| XLogP | 1.81 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|