C11H17ClN2O2 — CID 171209724
[3-[(1R)-1,3-diaminopropyl]phenyl] acetate;hydrochloride (PubChem CID 171209724) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is [3-[(1R)-1,3-diaminopropyl]phenyl] acetate;hydrochloride.
| Compound Name | [3-[(1R)-1,3-diaminopropyl]phenyl] acetate;hydrochloride |
|---|---|
| PubChem CID | 171209724 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | [3-[(1R)-1,3-diaminopropyl]phenyl] acetate;hydrochloride |
| SMILES | CC(=O)Oc1cccc([C@H](N)CCN)c1.Cl |
| InChI | InChI=1S/C11H16N2O2.ClH/c1-8(14)15-10-4-2-3-9(7-10)11(13)5-6-12;/h2-4,7,11H,5-6,12-13H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | SGBMLRCPNPMHSA-RFVHGSKJSA-N |
| XLogP | 1.38 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|