C12H17ClINO2 — CID 171249940
methyl (3S)-3-amino-3-(3-iodophenyl)-2,2-dimethylpropanoate;hydrochloride (PubChem CID 171249940) has the molecular formula C12H17ClINO2 and a molecular weight of 369.63 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(3-iodophenyl)-2,2-dimethylpropanoate;hydrochloride.
| Compound Name | methyl (3S)-3-amino-3-(3-iodophenyl)-2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 171249940 |
| Molecular Formula | C12H17ClINO2 |
| Molecular Weight | 369.63 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | methyl (3S)-3-amino-3-(3-iodophenyl)-2,2-dimethylpropanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)[C@@H](N)c1cccc(I)c1.Cl |
| InChI | InChI=1S/C12H16INO2.ClH/c1-12(2,11(15)16-3)10(14)8-5-4-6-9(13)7-8;/h4-7,10H,14H2,1-3H3;1H/t10-;/m0./s1 |
| InChIKey | RELPFYZLSWMOSF-PPHPATTJSA-N |
| XLogP | 2.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|