C11H17ClIN — CID 171243215
(1S)-1-(3-iodophenyl)-2,2-dimethylpropan-1-amine;hydrochloride (PubChem CID 171243215) has the molecular formula C11H17ClIN and a molecular weight of 325.62 g/mol. Its IUPAC name is (1S)-1-(3-iodophenyl)-2,2-dimethylpropan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(3-iodophenyl)-2,2-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171243215 |
| Molecular Formula | C11H17ClIN |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | (1S)-1-(3-iodophenyl)-2,2-dimethylpropan-1-amine;hydrochloride |
| SMILES | CC(C)(C)[C@H](N)c1cccc(I)c1.Cl |
| InChI | InChI=1S/C11H16IN.ClH/c1-11(2,3)10(13)8-5-4-6-9(12)7-8;/h4-7,10H,13H2,1-3H3;1H/t10-;/m1./s1 |
| InChIKey | PGMGGMSTHPDRJC-HNCPQSOCSA-N |
| XLogP | 3.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|