C11H15I2N — CID 130628960
(1S)-1-(2,5-diiodophenyl)-2,2-dimethylpropan-1-amine (PubChem CID 130628960) has the molecular formula C11H15I2N and a molecular weight of 415.06 g/mol. Its IUPAC name is (1S)-1-(2,5-diiodophenyl)-2,2-dimethylpropan-1-amine.
| Compound Name | (1S)-1-(2,5-diiodophenyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 130628960 |
| Molecular Formula | C11H15I2N |
| Molecular Weight | 415.06 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | (1S)-1-(2,5-diiodophenyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)[C@H](N)c1cc(I)ccc1I |
| InChI | InChI=1S/C11H15I2N/c1-11(2,3)10(14)8-6-7(12)4-5-9(8)13/h4-6,10H,14H2,1-3H3/t10-/m1/s1 |
| InChIKey | GDTCJNVBTXTHRN-SNVBAGLBSA-N |
| XLogP | 3.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.06 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|