C9H10I2 — CID 71000258
1,4-diiodo-2-propan-2-ylbenzene (PubChem CID 71000258) has the molecular formula C9H10I2 and a molecular weight of 371.99 g/mol. Its IUPAC name is 1,4-diiodo-2-propan-2-ylbenzene.
| Compound Name | 1,4-diiodo-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 71000258 |
| Molecular Formula | C9H10I2 |
| Molecular Weight | 371.99 g/mol |
| Exact Mass | 371.89 |
| IUPAC Name | 1,4-diiodo-2-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(I)ccc1I |
| InChI | InChI=1S/C9H10I2/c1-6(2)8-5-7(10)3-4-9(8)11/h3-6H,1-2H3 |
| InChIKey | KFGIQEDCSBGDPZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.99 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|