C12H19N — CID 93312698
(1R)-2,2-dimethyl-1-(3-methylphenyl)propan-1-amine (PubChem CID 93312698) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (1R)-2,2-dimethyl-1-(3-methylphenyl)propan-1-amine.
| Compound Name | (1R)-2,2-dimethyl-1-(3-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 93312698 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (1R)-2,2-dimethyl-1-(3-methylphenyl)propan-1-amine |
| SMILES | Cc1cccc([C@H](N)C(C)(C)C)c1 |
| InChI | InChI=1S/C12H19N/c1-9-6-5-7-10(8-9)11(13)12(2,3)4/h5-8,11H,13H2,1-4H3/t11-/m0/s1 |
| InChIKey | YNRFBIYHHSTFGJ-NSHDSACASA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |