About methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate
methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate (PubChem CID 116940265) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate.
Analyze methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate?
The IUPAC name of methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate (CID 116940265) is methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate.
What is the SMILES notation for methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate?
The canonical SMILES for methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate is COC(=O)C(C)(C)C(N)c1ccc(OC)c(OC)c1.
What is the InChIKey of methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate?
The InChIKey is ALYMVOQNWDKOJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4/c1-14(2,13(16)19-5)12(15)9-6-7-10(17-3)11(8-9)18-4/h6-8,12H,15H2,1-5H3.
What are the key properties of methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate?
methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate has a molecular weight of 267.32 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-3-(3,4-dimethoxyphenyl)-2,2-dimethylpropanoate is sourced from PubChem (CID 116940265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).