C13H19ClN2O5 — CID 171240607
methyl (3R)-3-amino-3-(4-methoxy-3-nitrophenyl)-2,2-dimethylpropanoate;hydrochloride (PubChem CID 171240607) has the molecular formula C13H19ClN2O5 and a molecular weight of 318.76 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(4-methoxy-3-nitrophenyl)-2,2-dimethylpropanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(4-methoxy-3-nitrophenyl)-2,2-dimethylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 171240607 |
| Molecular Formula | C13H19ClN2O5 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | methyl (3R)-3-amino-3-(4-methoxy-3-nitrophenyl)-2,2-dimethylpropanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)[C@H](N)c1ccc(OC)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C13H18N2O5.ClH/c1-13(2,12(16)20-4)11(14)8-5-6-10(19-3)9(7-8)15(17)18;/h5-7,11H,14H2,1-4H3;1H/t11-;/m1./s1 |
| InChIKey | SLCFQVIFQOQMRO-RFVHGSKJSA-N |
| XLogP | 2.22 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|