C11H17N3O3 — CID 171202812
(1R)-1-(4-methoxy-3-nitrophenyl)butane-1,4-diamine (PubChem CID 171202812) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is (1R)-1-(4-methoxy-3-nitrophenyl)butane-1,4-diamine.
| Compound Name | (1R)-1-(4-methoxy-3-nitrophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 171202812 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (1R)-1-(4-methoxy-3-nitrophenyl)butane-1,4-diamine |
| SMILES | COc1ccc([C@H](N)CCCN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N3O3/c1-17-11-5-4-8(7-10(11)14(15)16)9(13)3-2-6-12/h4-5,7,9H,2-3,6,12-13H2,1H3/t9-/m1/s1 |
| InChIKey | HIMZWFSUTQFUBT-SECBINFHSA-N |
| XLogP | 1.34 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|