C11H16N2O6P+ — CID 123215896
3-aminopropyl-dihydroxy-(4-methoxy-3-nitrobenzoyl)phosphanium (PubChem CID 123215896) has the molecular formula C11H16N2O6P+ and a molecular weight of 303.23 g/mol. Its IUPAC name is 3-aminopropyl-dihydroxy-(4-methoxy-3-nitrobenzoyl)phosphanium.
| Compound Name | 3-aminopropyl-dihydroxy-(4-methoxy-3-nitrobenzoyl)phosphanium |
|---|---|
| PubChem CID | 123215896 |
| Molecular Formula | C11H16N2O6P+ |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-aminopropyl-dihydroxy-(4-methoxy-3-nitrobenzoyl)phosphanium |
| SMILES | COc1ccc(C(=O)[P+](O)(O)CCCN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O6P/c1-19-10-4-3-8(7-9(10)13(15)16)11(14)20(17,18)6-2-5-12/h3-4,7,17-18H,2,5-6,12H2,1H3/q+1 |
| InChIKey | ZBRVJJGYMLLMHF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|