C12H16N2O9P+ — CID 90913770
[(3S)-3-amino-3-carboxypropyl]-dihydroxy-(4-hydroxy-3-methoxy-5-nitrobenzoyl)phosphanium (PubChem CID 90913770) has the molecular formula C12H16N2O9P+ and a molecular weight of 363.24 g/mol. Its IUPAC name is [(3S)-3-amino-3-carboxypropyl]-dihydroxy-(4-hydroxy-3-methoxy-5-nitrobenzoyl)phosphanium.
| Compound Name | [(3S)-3-amino-3-carboxypropyl]-dihydroxy-(4-hydroxy-3-methoxy-5-nitrobenzoyl)phosphanium |
|---|---|
| PubChem CID | 90913770 |
| Molecular Formula | C12H16N2O9P+ |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | [(3S)-3-amino-3-carboxypropyl]-dihydroxy-(4-hydroxy-3-methoxy-5-nitrobenzoyl)phosphanium |
| SMILES | COc1cc(C(=O)[P+](O)(O)CC[C@H](N)C(=O)O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C12H15N2O9P/c1-23-9-5-6(4-8(10(9)15)14(19)20)12(18)24(21,22)3-2-7(13)11(16)17/h4-5,7,21-22H,2-3,13H2,1H3,(H-,15,16,17,18)/p+1/t7-/m0/s1 |
| InChIKey | ZOXUCRYUDKDTLN-ZETCQYMHSA-O |
| XLogP | 0.08 |
| TPSA | 193.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|