C12H18ClN2O9P — CID 46898087
(2S)-2-amino-4-[hydroxy-[hydroxy-(4-hydroxy-3-methoxy-5-nitrophenyl)methyl]phosphoryl]butanoic acid;hydrochloride (PubChem CID 46898087) has the molecular formula C12H18ClN2O9P and a molecular weight of 400.71 g/mol. Its IUPAC name is (2S)-2-amino-4-[hydroxy-[hydroxy-(4-hydroxy-3-methoxy-5-nitrophenyl)methyl]phosphoryl]butanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-4-[hydroxy-[hydroxy-(4-hydroxy-3-methoxy-5-nitrophenyl)methyl]phosphoryl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 46898087 |
| Molecular Formula | C12H18ClN2O9P |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (2S)-2-amino-4-[hydroxy-[hydroxy-(4-hydroxy-3-methoxy-5-nitrophenyl)methyl]phosphoryl]butanoic acid;hydrochloride |
| SMILES | COc1cc(C(O)P(=O)(O)CC[C@H](N)C(=O)O)cc([N+](=O)[O-])c1O.Cl |
| InChI | InChI=1S/C12H17N2O9P.ClH/c1-23-9-5-6(4-8(10(9)15)14(19)20)12(18)24(21,22)3-2-7(13)11(16)17;/h4-5,7,12,15,18H,2-3,13H2,1H3,(H,16,17)(H,21,22);1H/t7-,12?;/m0./s1 |
| InChIKey | DHENNBRLHNYRPJ-ADEFDSRDSA-N |
| XLogP | 0.79 |
| TPSA | 193.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|