C29H32N3O12P — CID 66661184
[(4-hydroxy-3-methoxy-5-nitrophenyl)-(phenylmethoxycarbonylamino)methyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid (PubChem CID 66661184) has the molecular formula C29H32N3O12P and a molecular weight of 645.56 g/mol. Its IUPAC name is [(4-hydroxy-3-methoxy-5-nitrophenyl)-(phenylmethoxycarbonylamino)methyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid.
| Compound Name | [(4-hydroxy-3-methoxy-5-nitrophenyl)-(phenylmethoxycarbonylamino)methyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
|---|---|
| PubChem CID | 66661184 |
| Molecular Formula | C29H32N3O12P |
| Molecular Weight | 645.56 g/mol |
| Exact Mass | 645.17 |
| IUPAC Name | [(4-hydroxy-3-methoxy-5-nitrophenyl)-(phenylmethoxycarbonylamino)methyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
| SMILES | COC(=O)C(CCP(=O)(O)C(NC(=O)OCc1ccccc1)c1cc(OC)c(O)c([N+](=O)[O-])c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H32N3O12P/c1-41-24-16-21(15-23(25(24)33)32(37)38)26(31-29(36)44-18-20-11-7-4-8-12-20)45(39,40)14-13-22(27(34)42-2)30-28(35)43-17-19-9-5-3-6-10-19/h3-12,15-16,22,26,33H,13-14,17-18H2,1-2H3,(H,30,35)(H,31,36)(H,39,40) |
| InChIKey | PURMJOBJUGAGQR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 212.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|