C21H25N2O10P — CID 90994841
[hydroxy-(4-methoxy-3-nitrophenyl)methyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid (PubChem CID 90994841) has the molecular formula C21H25N2O10P and a molecular weight of 496.41 g/mol. Its IUPAC name is [hydroxy-(4-methoxy-3-nitrophenyl)methyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid.
| Compound Name | [hydroxy-(4-methoxy-3-nitrophenyl)methyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
|---|---|
| PubChem CID | 90994841 |
| Molecular Formula | C21H25N2O10P |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | [hydroxy-(4-methoxy-3-nitrophenyl)methyl]-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]phosphinic acid |
| SMILES | COC(=O)C(CCP(=O)(O)C(O)c1ccc(OC)c([N+](=O)[O-])c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25N2O10P/c1-31-18-9-8-15(12-17(18)23(27)28)20(25)34(29,30)11-10-16(19(24)32-2)22-21(26)33-13-14-6-4-3-5-7-14/h3-9,12,16,20,25H,10-11,13H2,1-2H3,(H,22,26)(H,29,30) |
| InChIKey | PSLXBUNCIAWBBA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 174.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|