C25H31N2O13P — CID 140638841
[(S)-[4-(2-ethoxy-2-oxoethoxy)-3-methoxy-5-nitrophenyl]-hydroxymethyl]-[4-oxo-4-(phenylmethoxycarbonylaminomethoxy)butyl]phosphinic acid (PubChem CID 140638841) has the molecular formula C25H31N2O13P and a molecular weight of 598.50 g/mol. Its IUPAC name is [(S)-[4-(2-ethoxy-2-oxoethoxy)-3-methoxy-5-nitrophenyl]-hydroxymethyl]-[4-oxo-4-(phenylmethoxycarbonylaminomethoxy)butyl]phosphinic acid.
| Compound Name | [(S)-[4-(2-ethoxy-2-oxoethoxy)-3-methoxy-5-nitrophenyl]-hydroxymethyl]-[4-oxo-4-(phenylmethoxycarbonylaminomethoxy)butyl]phosphinic acid |
|---|---|
| PubChem CID | 140638841 |
| Molecular Formula | C25H31N2O13P |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | [(S)-[4-(2-ethoxy-2-oxoethoxy)-3-methoxy-5-nitrophenyl]-hydroxymethyl]-[4-oxo-4-(phenylmethoxycarbonylaminomethoxy)butyl]phosphinic acid |
| SMILES | CCOC(=O)COc1c(OC)cc([C@@H](O)P(=O)(O)CCCC(=O)OCNC(=O)OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H31N2O13P/c1-3-37-22(29)15-38-23-19(27(32)33)12-18(13-20(23)36-2)24(30)41(34,35)11-7-10-21(28)40-16-26-25(31)39-14-17-8-5-4-6-9-17/h4-6,8-9,12-13,24,30H,3,7,10-11,14-16H2,1-2H3,(H,26,31)(H,34,35)/t24-/m0/s1 |
| InChIKey | RIWGSYQXSNOFSQ-DEOSSOPVSA-N |
| XLogP | 3.01 |
| TPSA | 210.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|