C27H29N2O7P — CID 135065879
ethyl 2-[phenyl-[phenyl-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]phosphoryl]oxyacetate (PubChem CID 135065879) has the molecular formula C27H29N2O7P and a molecular weight of 524.51 g/mol. Its IUPAC name is ethyl 2-[phenyl-[phenyl-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]phosphoryl]oxyacetate.
| Compound Name | ethyl 2-[phenyl-[phenyl-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]phosphoryl]oxyacetate |
|---|---|
| PubChem CID | 135065879 |
| Molecular Formula | C27H29N2O7P |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | ethyl 2-[phenyl-[phenyl-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]phosphoryl]oxyacetate |
| SMILES | CCOC(=O)COP(=O)(c1ccccc1)C(NC(=O)CNC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29N2O7P/c1-2-34-25(31)20-36-37(33,23-16-10-5-11-17-23)26(22-14-8-4-9-15-22)29-24(30)18-28-27(32)35-19-21-12-6-3-7-13-21/h3-17,26H,2,18-20H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | NCDMRVBAGLISHU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|