C28H31N2O7P — CID 135064632
ethyl 2-[[(4-methylphenyl)-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]-phenylphosphoryl]oxyacetate (PubChem CID 135064632) has the molecular formula C28H31N2O7P and a molecular weight of 538.54 g/mol. Its IUPAC name is ethyl 2-[[(4-methylphenyl)-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]-phenylphosphoryl]oxyacetate.
| Compound Name | ethyl 2-[[(4-methylphenyl)-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]-phenylphosphoryl]oxyacetate |
|---|---|
| PubChem CID | 135064632 |
| Molecular Formula | C28H31N2O7P |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | ethyl 2-[[(4-methylphenyl)-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]-phenylphosphoryl]oxyacetate |
| SMILES | CCOC(=O)COP(=O)(c1ccccc1)C(NC(=O)CNC(=O)OCc1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H31N2O7P/c1-3-35-26(32)20-37-38(34,24-12-8-5-9-13-24)27(23-16-14-21(2)15-17-23)30-25(31)18-29-28(33)36-19-22-10-6-4-7-11-22/h4-17,27H,3,18-20H2,1-2H3,(H,29,33)(H,30,31) |
| InChIKey | FLQIBVVOHISOGR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|