C27H34N2O8 — CID 166820857
2-methylpropyl 3-[4-(2-ethoxy-2-oxoethoxy)phenyl]-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate (PubChem CID 166820857) has the molecular formula C27H34N2O8 and a molecular weight of 514.58 g/mol. Its IUPAC name is 2-methylpropyl 3-[4-(2-ethoxy-2-oxoethoxy)phenyl]-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate.
| Compound Name | 2-methylpropyl 3-[4-(2-ethoxy-2-oxoethoxy)phenyl]-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 166820857 |
| Molecular Formula | C27H34N2O8 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 2-methylpropyl 3-[4-(2-ethoxy-2-oxoethoxy)phenyl]-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate |
| SMILES | CCOC(=O)COc1ccc(CC(NC(=O)CNC(=O)OCc2ccccc2)C(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C27H34N2O8/c1-4-34-25(31)18-35-22-12-10-20(11-13-22)14-23(26(32)36-16-19(2)3)29-24(30)15-28-27(33)37-17-21-8-6-5-7-9-21/h5-13,19,23H,4,14-18H2,1-3H3,(H,28,33)(H,29,30) |
| InChIKey | YZUDTKGYTJMFNK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|