C20H23NO5 — CID 139716314
benzyl (2S)-2-amino-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]propanoate (PubChem CID 139716314) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is benzyl (2S)-2-amino-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]propanoate.
| Compound Name | benzyl (2S)-2-amino-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 139716314 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | benzyl (2S)-2-amino-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)COc1ccc(C[C@H](N)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-2-24-19(22)14-25-17-10-8-15(9-11-17)12-18(21)20(23)26-13-16-6-4-3-5-7-16/h3-11,18H,2,12-14,21H2,1H3/t18-/m0/s1 |
| InChIKey | AMQRHPDFDHGBDJ-SFHVURJKSA-N |
| XLogP | 2.24 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |