C18H20FNO3 — CID 170885350
ethyl 2-amino-3-[4-[(2-fluorophenyl)methoxy]phenyl]propanoate (PubChem CID 170885350) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is ethyl 2-amino-3-[4-[(2-fluorophenyl)methoxy]phenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[4-[(2-fluorophenyl)methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 170885350 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl 2-amino-3-[4-[(2-fluorophenyl)methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H20FNO3/c1-2-22-18(21)17(20)11-13-7-9-15(10-8-13)23-12-14-5-3-4-6-16(14)19/h3-10,17H,2,11-12,20H2,1H3 |
| InChIKey | BSEAEVSRYYHKKE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |