C23H26N2O8 — CID 164714534
[2-(phenylmethoxycarbonylamino)acetyl] (2S)-2-amino-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]propanoate (PubChem CID 164714534) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is [2-(phenylmethoxycarbonylamino)acetyl] (2S)-2-amino-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]propanoate.
| Compound Name | [2-(phenylmethoxycarbonylamino)acetyl] (2S)-2-amino-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 164714534 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | [2-(phenylmethoxycarbonylamino)acetyl] (2S)-2-amino-3-[4-(2-ethoxy-2-oxoethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)COc1ccc(C[C@H](N)C(=O)OC(=O)CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O8/c1-2-30-21(27)15-31-18-10-8-16(9-11-18)12-19(24)22(28)33-20(26)13-25-23(29)32-14-17-6-4-3-5-7-17/h3-11,19H,2,12-15,24H2,1H3,(H,25,29)/t19-/m0/s1 |
| InChIKey | NGOXTEFHRFEIOM-IBGZPJMESA-N |
| XLogP | 1.49 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|