C26H28N3O6P — CID 141167008
2-[[[(4-methylphenyl)-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]-phenylphosphoryl]amino]acetic acid (PubChem CID 141167008) has the molecular formula C26H28N3O6P and a molecular weight of 509.50 g/mol. Its IUPAC name is 2-[[[(4-methylphenyl)-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]-phenylphosphoryl]amino]acetic acid.
| Compound Name | 2-[[[(4-methylphenyl)-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]-phenylphosphoryl]amino]acetic acid |
|---|---|
| PubChem CID | 141167008 |
| Molecular Formula | C26H28N3O6P |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 2-[[[(4-methylphenyl)-[[2-(phenylmethoxycarbonylamino)acetyl]amino]methyl]-phenylphosphoryl]amino]acetic acid |
| SMILES | Cc1ccc(C(NC(=O)CNC(=O)OCc2ccccc2)P(=O)(NCC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N3O6P/c1-19-12-14-21(15-13-19)25(36(34,28-17-24(31)32)22-10-6-3-7-11-22)29-23(30)16-27-26(33)35-18-20-8-4-2-5-9-20/h2-15,25H,16-18H2,1H3,(H,27,33)(H,28,34)(H,29,30)(H,31,32) |
| InChIKey | TUDVPEPHIBUUGC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|